C19H20O3 — CID 134961689
(3R)-5-(1,3-benzodioxol-5-yl)-4-methyl-3-phenylpentanal (PubChem CID 134961689) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3R)-5-(1,3-benzodioxol-5-yl)-4-methyl-3-phenylpentanal.
| Compound Name | (3R)-5-(1,3-benzodioxol-5-yl)-4-methyl-3-phenylpentanal |
|---|---|
| PubChem CID | 134961689 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3R)-5-(1,3-benzodioxol-5-yl)-4-methyl-3-phenylpentanal |
| SMILES | CC(Cc1ccc2c(c1)OCO2)[C@@H](CC=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O3/c1-14(17(9-10-20)16-5-3-2-4-6-16)11-15-7-8-18-19(12-15)22-13-21-18/h2-8,10,12,14,17H,9,11,13H2,1H3/t14?,17-/m1/s1 |
| InChIKey | JXQFKUDRFIJWDD-FBMWCMRBSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|