C22H18O4 — CID 154709114
5-[(1S)-2-(1,3-benzodioxol-5-yl)-1-phenylethyl]-1,3-benzodioxole (PubChem CID 154709114) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-[(1S)-2-(1,3-benzodioxol-5-yl)-1-phenylethyl]-1,3-benzodioxole.
| Compound Name | 5-[(1S)-2-(1,3-benzodioxol-5-yl)-1-phenylethyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 154709114 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-[(1S)-2-(1,3-benzodioxol-5-yl)-1-phenylethyl]-1,3-benzodioxole |
| SMILES | c1ccc([C@H](Cc2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H18O4/c1-2-4-16(5-3-1)18(17-7-9-20-22(12-17)26-14-24-20)10-15-6-8-19-21(11-15)25-13-23-19/h1-9,11-12,18H,10,13-14H2/t18-/m0/s1 |
| InChIKey | OWJHTPOOEMRLNF-SFHVURJKSA-N |
| XLogP | 4.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |