C16H13NO2 — CID 940181
(3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropanenitrile (PubChem CID 940181) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropanenitrile.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 940181 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropanenitrile |
| SMILES | N#CC[C@@H](c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13NO2/c17-9-8-14(12-4-2-1-3-5-12)13-6-7-15-16(10-13)19-11-18-15/h1-7,10,14H,8,11H2/t14-/m0/s1 |
| InChIKey | LWJBRGFHRUMKQK-AWEZNQCLSA-N |
| XLogP | 3.46 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |