C22H18N2O2 — CID 101483032
(2S)-2-(benzhydrylamino)-2-(1,3-benzodioxol-5-yl)acetonitrile (PubChem CID 101483032) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2S)-2-(benzhydrylamino)-2-(1,3-benzodioxol-5-yl)acetonitrile.
| Compound Name | (2S)-2-(benzhydrylamino)-2-(1,3-benzodioxol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 101483032 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2S)-2-(benzhydrylamino)-2-(1,3-benzodioxol-5-yl)acetonitrile |
| SMILES | N#C[C@@H](NC(c1ccccc1)c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H18N2O2/c23-14-19(18-11-12-20-21(13-18)26-15-25-20)24-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,19,22,24H,15H2/t19-/m1/s1 |
| InChIKey | BREUAUJFAASREC-LJQANCHMSA-N |
| XLogP | 4.36 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |