C17H16N2O2 — CID 82020032
2-(1,3-benzodioxol-5-yl)-2-(2-phenylethylamino)acetonitrile (PubChem CID 82020032) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-(2-phenylethylamino)acetonitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-(2-phenylethylamino)acetonitrile |
|---|---|
| PubChem CID | 82020032 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-(2-phenylethylamino)acetonitrile |
| SMILES | N#CC(NCCc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O2/c18-11-15(19-9-8-13-4-2-1-3-5-13)14-6-7-16-17(10-14)21-12-20-16/h1-7,10,15,19H,8-9,12H2 |
| InChIKey | FDOOKJBEKYVIBV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |