C16H18N2O2 — CID 60896071
1-(1,3-benzodioxol-5-yl)-N-(2-pyridin-3-ylethyl)ethanamine (PubChem CID 60896071) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(2-pyridin-3-ylethyl)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(2-pyridin-3-ylethyl)ethanamine |
|---|---|
| PubChem CID | 60896071 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(2-pyridin-3-ylethyl)ethanamine |
| SMILES | CC(NCCc1cccnc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18N2O2/c1-12(18-8-6-13-3-2-7-17-10-13)14-4-5-15-16(9-14)20-11-19-15/h2-5,7,9-10,12,18H,6,8,11H2,1H3 |
| InChIKey | WDWZLMORLVISLR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |