C14H15N3O2 — CID 62762166
1-(1,3-benzodioxol-5-yl)-N-(pyrazin-2-ylmethyl)ethanamine (PubChem CID 62762166) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(pyrazin-2-ylmethyl)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(pyrazin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62762166 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(pyrazin-2-ylmethyl)ethanamine |
| SMILES | CC(NCc1cnccn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15N3O2/c1-10(17-8-12-7-15-4-5-16-12)11-2-3-13-14(6-11)19-9-18-13/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | XRIFOEQYCDAXDP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |