C13H16N2O3 — CID 62586070
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-hydroxypropylamino)acetonitrile (PubChem CID 62586070) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-hydroxypropylamino)acetonitrile.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-hydroxypropylamino)acetonitrile |
|---|---|
| PubChem CID | 62586070 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-hydroxypropylamino)acetonitrile |
| SMILES | N#CC(NCCCO)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H16N2O3/c14-9-11(15-4-1-5-16)10-2-3-12-13(8-10)18-7-6-17-12/h2-3,8,11,15-16H,1,4-7H2 |
| InChIKey | DIPATZVMQWUFFJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|