C17H18N2O2 — CID 62585886
2-(3-hydroxypropylamino)-2-(3-phenoxyphenyl)acetonitrile (PubChem CID 62585886) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-2-(3-phenoxyphenyl)acetonitrile.
| Compound Name | 2-(3-hydroxypropylamino)-2-(3-phenoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 62585886 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-(3-hydroxypropylamino)-2-(3-phenoxyphenyl)acetonitrile |
| SMILES | N#CC(NCCCO)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O2/c18-13-17(19-10-5-11-20)14-6-4-9-16(12-14)21-15-7-2-1-3-8-15/h1-4,6-9,12,17,19-20H,5,10-11H2 |
| InChIKey | GOGQELSHEUMDGE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|