C11H11F3N2O — CID 55090776
2-(2-hydroxyethylamino)-2-[3-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 55090776) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-2-[3-(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2-(2-hydroxyethylamino)-2-[3-(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 55090776 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-(2-hydroxyethylamino)-2-[3-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#CC(NCCO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)9-3-1-2-8(6-9)10(7-15)16-4-5-17/h1-3,6,10,16-17H,4-5H2 |
| InChIKey | LHXGLZWYCCYTSM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |