C12H16N2O2 — CID 62587499
2-(2-hydroxyethylamino)-2-(4-methoxy-3-methylphenyl)acetonitrile (PubChem CID 62587499) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-2-(4-methoxy-3-methylphenyl)acetonitrile.
| Compound Name | 2-(2-hydroxyethylamino)-2-(4-methoxy-3-methylphenyl)acetonitrile |
|---|---|
| PubChem CID | 62587499 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(2-hydroxyethylamino)-2-(4-methoxy-3-methylphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)NCCO)cc1C |
| InChI | InChI=1S/C12H16N2O2/c1-9-7-10(3-4-12(9)16-2)11(8-13)14-5-6-15/h3-4,7,11,14-15H,5-6H2,1-2H3 |
| InChIKey | NFNLRIKBJNVGQD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |