C13H16F2N2O2 — CID 43115215
2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(propylamino)acetonitrile (PubChem CID 43115215) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(propylamino)acetonitrile.
| Compound Name | 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(propylamino)acetonitrile |
|---|---|
| PubChem CID | 43115215 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(propylamino)acetonitrile |
| SMILES | CCCNC(C#N)c1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-3-6-17-10(8-16)9-4-5-11(18-2)12(7-9)19-13(14)15/h4-5,7,10,13,17H,3,6H2,1-2H3 |
| InChIKey | CQTFRVHPZHBJLP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |