C13H17F2NO4 — CID 60788246
ethyl 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methylamino)acetate (PubChem CID 60788246) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is ethyl 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methylamino)acetate.
| Compound Name | ethyl 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methylamino)acetate |
|---|---|
| PubChem CID | 60788246 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl 2-[3-(difluoromethoxy)-4-methoxyphenyl]-2-(methylamino)acetate |
| SMILES | CCOC(=O)C(NC)c1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H17F2NO4/c1-4-19-12(17)11(16-2)8-5-6-9(18-3)10(7-8)20-13(14)15/h5-7,11,13,16H,4H2,1-3H3 |
| InChIKey | BTLIJPCCSIWOLC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |