C14H19F2NO4 — CID 43148359
ethyl 2-(aminomethyl)-3-[3-(difluoromethoxy)-4-methoxyphenyl]propanoate (PubChem CID 43148359) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-3-[3-(difluoromethoxy)-4-methoxyphenyl]propanoate.
| Compound Name | ethyl 2-(aminomethyl)-3-[3-(difluoromethoxy)-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 43148359 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | ethyl 2-(aminomethyl)-3-[3-(difluoromethoxy)-4-methoxyphenyl]propanoate |
| SMILES | CCOC(=O)C(CN)Cc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C14H19F2NO4/c1-3-20-13(18)10(8-17)6-9-4-5-11(19-2)12(7-9)21-14(15)16/h4-5,7,10,14H,3,6,8,17H2,1-2H3 |
| InChIKey | PLZNJJZDMNCNBS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |