C14H15F2N3O4 — CID 91252854
ethyl 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2H-triazole-4-carboxylate (PubChem CID 91252854) has the molecular formula C14H15F2N3O4 and a molecular weight of 327.29 g/mol. Its IUPAC name is ethyl 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 91252854 |
| Molecular Formula | C14H15F2N3O4 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | ethyl 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1Cc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C14H15F2N3O4/c1-3-22-13(20)12-9(17-19-18-12)6-8-4-5-10(21-2)11(7-8)23-14(15)16/h4-5,7,14H,3,6H2,1-2H3,(H,17,18,19) |
| InChIKey | JKPNRWGCXNSBOG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |