C13H16F2O4 — CID 78805538
[4-(difluoromethoxy)-3-methoxyphenyl]methyl butanoate (PubChem CID 78805538) has the molecular formula C13H16F2O4 and a molecular weight of 274.26 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]methyl butanoate.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl butanoate |
|---|---|
| PubChem CID | 78805538 |
| Molecular Formula | C13H16F2O4 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl butanoate |
| SMILES | CCCC(=O)OCc1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C13H16F2O4/c1-3-4-12(16)18-8-9-5-6-10(19-13(14)15)11(7-9)17-2/h5-7,13H,3-4,8H2,1-2H3 |
| InChIKey | IRVUTKYPGYCVMI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |