C19H19F3O5 — CID 78805042
[4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(4-fluorophenoxy)-2-methylpropanoate (PubChem CID 78805042) has the molecular formula C19H19F3O5 and a molecular weight of 384.35 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(4-fluorophenoxy)-2-methylpropanoate.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(4-fluorophenoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 78805042 |
| Molecular Formula | C19H19F3O5 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(4-fluorophenoxy)-2-methylpropanoate |
| SMILES | COc1cc(COC(=O)C(C)(C)Oc2ccc(F)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F3O5/c1-19(2,27-14-7-5-13(20)6-8-14)17(23)25-11-12-4-9-15(26-18(21)22)16(10-12)24-3/h4-10,18H,11H2,1-3H3 |
| InChIKey | ZSUSEFBYWOZSAS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |