C13H17F2NO4 — CID 60648152
3-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]propanoic acid (PubChem CID 60648152) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]propanoic acid.
| Compound Name | 3-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 60648152 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]propanoic acid |
| SMILES | COc1cc(CN(C)CCC(=O)O)ccc1OC(F)F |
| InChI | InChI=1S/C13H17F2NO4/c1-16(6-5-12(17)18)8-9-3-4-10(20-13(14)15)11(7-9)19-2/h3-4,7,13H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | WKLALTUQWSVQIJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |