C18H21F2NO3 — CID 2119817
(1S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-1-phenylethanol (PubChem CID 2119817) has the molecular formula C18H21F2NO3 and a molecular weight of 337.37 g/mol. Its IUPAC name is (1S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-1-phenylethanol.
| Compound Name | (1S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 2119817 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (1S)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-1-phenylethanol |
| SMILES | COc1cc(CN(C)C[C@@H](O)c2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H21F2NO3/c1-21(12-15(22)14-6-4-3-5-7-14)11-13-8-9-16(24-18(19)20)17(10-13)23-2/h3-10,15,18,22H,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | XEZVHACTMHITCR-OAHLLOKOSA-N |
| XLogP | 3.46 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |