C12H11FN2O — CID 65096153
2-(3-fluoro-4-methoxyphenyl)-2-(prop-2-ynylamino)acetonitrile (PubChem CID 65096153) has the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-2-(prop-2-ynylamino)acetonitrile.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-2-(prop-2-ynylamino)acetonitrile |
|---|---|
| PubChem CID | 65096153 |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-2-(prop-2-ynylamino)acetonitrile |
| SMILES | C#CCNC(C#N)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C12H11FN2O/c1-3-6-15-11(8-14)9-4-5-12(16-2)10(13)7-9/h1,4-5,7,11,15H,6H2,2H3 |
| InChIKey | VBTXZARMEPFADM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|