C16H21FN2O — CID 65096774
2-(cycloheptylamino)-2-(3-fluoro-4-methoxyphenyl)acetonitrile (PubChem CID 65096774) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(cycloheptylamino)-2-(3-fluoro-4-methoxyphenyl)acetonitrile.
| Compound Name | 2-(cycloheptylamino)-2-(3-fluoro-4-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 65096774 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(cycloheptylamino)-2-(3-fluoro-4-methoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)NC2CCCCCC2)cc1F |
| InChI | InChI=1S/C16H21FN2O/c1-20-16-9-8-12(10-14(16)17)15(11-18)19-13-6-4-2-3-5-7-13/h8-10,13,15,19H,2-7H2,1H3 |
| InChIKey | ATVXHGPBMQSRIP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |