C13H14Cl2N2 — CID 54894364
2-(cyclopentylamino)-2-(3,4-dichlorophenyl)acetonitrile (PubChem CID 54894364) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-(cyclopentylamino)-2-(3,4-dichlorophenyl)acetonitrile.
| Compound Name | 2-(cyclopentylamino)-2-(3,4-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54894364 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(cyclopentylamino)-2-(3,4-dichlorophenyl)acetonitrile |
| SMILES | N#CC(NC1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2/c14-11-6-5-9(7-12(11)15)13(8-16)17-10-3-1-2-4-10/h5-7,10,13,17H,1-4H2 |
| InChIKey | NGFBDAPQCXWJAD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |