C9H8Cl2N2 — CID 28899008
(2S)-2-(3,4-dichlorophenyl)-2-(methylamino)acetonitrile (PubChem CID 28899008) has the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. Its IUPAC name is (2S)-2-(3,4-dichlorophenyl)-2-(methylamino)acetonitrile.
| Compound Name | (2S)-2-(3,4-dichlorophenyl)-2-(methylamino)acetonitrile |
|---|---|
| PubChem CID | 28899008 |
| Molecular Formula | C9H8Cl2N2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | (2S)-2-(3,4-dichlorophenyl)-2-(methylamino)acetonitrile |
| SMILES | CN[C@H](C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2/c1-13-9(5-12)6-2-3-7(10)8(11)4-6/h2-4,9,13H,1H3/t9-/m1/s1 |
| InChIKey | QTCGYGMHAOBASQ-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |