C8H9Cl2NS — CID 116954570
(3,4-dichlorophenyl)-(methylamino)methanethiol (PubChem CID 116954570) has the molecular formula C8H9Cl2NS and a molecular weight of 222.14 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(methylamino)methanethiol.
| Compound Name | (3,4-dichlorophenyl)-(methylamino)methanethiol |
|---|---|
| PubChem CID | 116954570 |
| Molecular Formula | C8H9Cl2NS |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | (3,4-dichlorophenyl)-(methylamino)methanethiol |
| SMILES | CNC(S)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2NS/c1-11-8(12)5-2-3-6(9)7(10)4-5/h2-4,8,11-12H,1H3 |
| InChIKey | SLNHOMOXRPIJAY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|