C11H16Cl2N2 — CID 116948774
1-(3,4-dichlorophenyl)-N,2-dimethylpropane-1,3-diamine (PubChem CID 116948774) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N,2-dimethylpropane-1,3-diamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116948774 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N,2-dimethylpropane-1,3-diamine |
| SMILES | CNC(c1ccc(Cl)c(Cl)c1)C(C)CN |
| InChI | InChI=1S/C11H16Cl2N2/c1-7(6-14)11(15-2)8-3-4-9(12)10(13)5-8/h3-5,7,11,15H,6,14H2,1-2H3 |
| InChIKey | MDCAVXGAFQGROI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |