C15H23Cl2N — CID 43486466
1-(3,4-dichlorophenyl)-2-ethyl-N-methylhexan-1-amine (PubChem CID 43486466) has the molecular formula C15H23Cl2N and a molecular weight of 288.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-ethyl-N-methylhexan-1-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-ethyl-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 43486466 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-ethyl-N-methylhexan-1-amine |
| SMILES | CCCCC(CC)C(NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H23Cl2N/c1-4-6-7-11(5-2)15(18-3)12-8-9-13(16)14(17)10-12/h8-11,15,18H,4-7H2,1-3H3 |
| InChIKey | BPLBBYGTLBRHQK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |