C13H18Cl2 — CID 175611327
1,2-dichloro-4-heptan-3-ylbenzene (PubChem CID 175611327) has the molecular formula C13H18Cl2 and a molecular weight of 245.19 g/mol. Its IUPAC name is 1,2-dichloro-4-heptan-3-ylbenzene.
| Compound Name | 1,2-dichloro-4-heptan-3-ylbenzene |
|---|---|
| PubChem CID | 175611327 |
| Molecular Formula | C13H18Cl2 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1,2-dichloro-4-heptan-3-ylbenzene |
| SMILES | CCCCC(CC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2/c1-3-5-6-10(4-2)11-7-8-12(14)13(15)9-11/h7-10H,3-6H2,1-2H3 |
| InChIKey | GPJBIBROLHTXDB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |