C14H20Cl2 — CID 67949273
1,2-dichloro-4-(2-methylheptan-4-yl)benzene (PubChem CID 67949273) has the molecular formula C14H20Cl2 and a molecular weight of 259.22 g/mol. Its IUPAC name is 1,2-dichloro-4-(2-methylheptan-4-yl)benzene.
| Compound Name | 1,2-dichloro-4-(2-methylheptan-4-yl)benzene |
|---|---|
| PubChem CID | 67949273 |
| Molecular Formula | C14H20Cl2 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,2-dichloro-4-(2-methylheptan-4-yl)benzene |
| SMILES | CCCC(CC(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2/c1-4-5-11(8-10(2)3)12-6-7-13(15)14(16)9-12/h6-7,9-11H,4-5,8H2,1-3H3 |
| InChIKey | DGTYUUQZICHZLH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |