C8H6Cl2N2 — CID 30082276
(2R)-2-amino-2-(3,4-dichlorophenyl)acetonitrile (PubChem CID 30082276) has the molecular formula C8H6Cl2N2 and a molecular weight of 201.06 g/mol. Its IUPAC name is (2R)-2-amino-2-(3,4-dichlorophenyl)acetonitrile.
| Compound Name | (2R)-2-amino-2-(3,4-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 30082276 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | (2R)-2-amino-2-(3,4-dichlorophenyl)acetonitrile |
| SMILES | N#C[C@H](N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2N2/c9-6-2-1-5(3-7(6)10)8(12)4-11/h1-3,8H,12H2/t8-/m0/s1 |
| InChIKey | OIJOTGFCYGNHDS-QMMMGPOBSA-N |
| XLogP | 2.52 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |