C10H7Cl2NO — CID 86325553
(2S)-2-(3,4-dichlorophenyl)-3-oxobutanenitrile (PubChem CID 86325553) has the molecular formula C10H7Cl2NO and a molecular weight of 228.08 g/mol. Its IUPAC name is (2S)-2-(3,4-dichlorophenyl)-3-oxobutanenitrile.
| Compound Name | (2S)-2-(3,4-dichlorophenyl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 86325553 |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (2S)-2-(3,4-dichlorophenyl)-3-oxobutanenitrile |
| SMILES | CC(=O)[C@H](C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2NO/c1-6(14)8(5-13)7-2-3-9(11)10(12)4-7/h2-4,8H,1H3/t8-/m0/s1 |
| InChIKey | JDRJWFLOZMCQMW-QMMMGPOBSA-N |
| XLogP | 3.19 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |