C11H7Cl2F2NO — CID 142535134
2-(3,4-dichlorophenyl)-4,4-difluoro-3-oxopentanenitrile (PubChem CID 142535134) has the molecular formula C11H7Cl2F2NO and a molecular weight of 278.09 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4,4-difluoro-3-oxopentanenitrile.
| Compound Name | 2-(3,4-dichlorophenyl)-4,4-difluoro-3-oxopentanenitrile |
|---|---|
| PubChem CID | 142535134 |
| Molecular Formula | C11H7Cl2F2NO |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4,4-difluoro-3-oxopentanenitrile |
| SMILES | CC(F)(F)C(=O)C(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2F2NO/c1-11(14,15)10(17)7(5-16)6-2-3-8(12)9(13)4-6/h2-4,7H,1H3 |
| InChIKey | HUWVUHKXIQBGPY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |