C17H21Cl2NO — CID 65427682
2-(3,4-dichlorophenyl)-3-oxoundecanenitrile (PubChem CID 65427682) has the molecular formula C17H21Cl2NO and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-oxoundecanenitrile.
| Compound Name | 2-(3,4-dichlorophenyl)-3-oxoundecanenitrile |
|---|---|
| PubChem CID | 65427682 |
| Molecular Formula | C17H21Cl2NO |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-oxoundecanenitrile |
| SMILES | CCCCCCCCC(=O)C(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2NO/c1-2-3-4-5-6-7-8-17(21)14(12-20)13-9-10-15(18)16(19)11-13/h9-11,14H,2-8H2,1H3 |
| InChIKey | UWWGYDOTFVXTRW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|