C16H17Cl2NO2 — CID 63952950
2-(3,4-dichlorophenyl)-5-(oxan-2-yl)-3-oxopentanenitrile (PubChem CID 63952950) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-(oxan-2-yl)-3-oxopentanenitrile.
| Compound Name | 2-(3,4-dichlorophenyl)-5-(oxan-2-yl)-3-oxopentanenitrile |
|---|---|
| PubChem CID | 63952950 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-(oxan-2-yl)-3-oxopentanenitrile |
| SMILES | N#CC(C(=O)CCC1CCCCO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO2/c17-14-6-4-11(9-15(14)18)13(10-19)16(20)7-5-12-3-1-2-8-21-12/h4,6,9,12-13H,1-3,5,7-8H2 |
| InChIKey | ZZNKIHLXAVALEX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |