C15H18Cl2O2 — CID 65167105
1-(3,4-dichlorophenyl)-5-(oxolan-2-yl)pentan-2-one (PubChem CID 65167105) has the molecular formula C15H18Cl2O2 and a molecular weight of 301.21 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5-(oxolan-2-yl)pentan-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-5-(oxolan-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 65167105 |
| Molecular Formula | C15H18Cl2O2 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5-(oxolan-2-yl)pentan-2-one |
| SMILES | O=C(CCCC1CCCO1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2O2/c16-14-7-6-11(10-15(14)17)9-12(18)3-1-4-13-5-2-8-19-13/h6-7,10,13H,1-5,8-9H2 |
| InChIKey | ISPARKBMNKBZJA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |