C13H14Cl2O2 — CID 65155022
1-(3,4-dichlorophenyl)-3-(oxolan-2-yl)propan-1-one (PubChem CID 65155022) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(oxolan-2-yl)propan-1-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(oxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 65155022 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(oxolan-2-yl)propan-1-one |
| SMILES | O=C(CCC1CCCO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2O2/c14-11-5-3-9(8-12(11)15)13(16)6-4-10-2-1-7-17-10/h3,5,8,10H,1-2,4,6-7H2 |
| InChIKey | NLUMGYYOHKIARN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |