C13H12Cl4O2 — CID 105349439
3-(oxolan-2-yl)-1-(2,3,4,6-tetrachlorophenyl)propan-1-one (PubChem CID 105349439) has the molecular formula C13H12Cl4O2 and a molecular weight of 342.05 g/mol. Its IUPAC name is 3-(oxolan-2-yl)-1-(2,3,4,6-tetrachlorophenyl)propan-1-one.
| Compound Name | 3-(oxolan-2-yl)-1-(2,3,4,6-tetrachlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 105349439 |
| Molecular Formula | C13H12Cl4O2 |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 3-(oxolan-2-yl)-1-(2,3,4,6-tetrachlorophenyl)propan-1-one |
| SMILES | O=C(CCC1CCCO1)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl4O2/c14-8-6-9(15)12(16)13(17)11(8)10(18)4-3-7-2-1-5-19-7/h6-7H,1-5H2 |
| InChIKey | HFOLXXMWIXOACG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|