C17H22O2 — CID 63953931
1-(2,3-dihydro-1H-inden-5-yl)-3-(oxan-2-yl)propan-1-one (PubChem CID 63953931) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-3-(oxan-2-yl)propan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(oxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 63953931 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(oxan-2-yl)propan-1-one |
| SMILES | O=C(CCC1CCCCO1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H22O2/c18-17(10-9-16-6-1-2-11-19-16)15-8-7-13-4-3-5-14(13)12-15/h7-8,12,16H,1-6,9-11H2 |
| InChIKey | RXLPCQCBPCISQU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |