C16H22O4 — CID 65155375
1-(3,4-dimethoxyphenyl)-4-(oxolan-2-yl)butan-2-one (PubChem CID 65155375) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-(oxolan-2-yl)butan-2-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-(oxolan-2-yl)butan-2-one |
|---|---|
| PubChem CID | 65155375 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-(oxolan-2-yl)butan-2-one |
| SMILES | COc1ccc(CC(=O)CCC2CCCO2)cc1OC |
| InChI | InChI=1S/C16H22O4/c1-18-15-8-5-12(11-16(15)19-2)10-13(17)6-7-14-4-3-9-20-14/h5,8,11,14H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | FLDCPFDTXOKYHH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |