C14H19ClO3 — CID 65162791
2-[2-[4-(chloromethyl)-2-methoxyphenoxy]ethyl]oxolane (PubChem CID 65162791) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[2-[4-(chloromethyl)-2-methoxyphenoxy]ethyl]oxolane.
| Compound Name | 2-[2-[4-(chloromethyl)-2-methoxyphenoxy]ethyl]oxolane |
|---|---|
| PubChem CID | 65162791 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[2-[4-(chloromethyl)-2-methoxyphenoxy]ethyl]oxolane |
| SMILES | COc1cc(CCl)ccc1OCCC1CCCO1 |
| InChI | InChI=1S/C14H19ClO3/c1-16-14-9-11(10-15)4-5-13(14)18-8-6-12-3-2-7-17-12/h4-5,9,12H,2-3,6-8,10H2,1H3 |
| InChIKey | JCRSLVQYAPUQGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|