C14H18Cl2O3 — CID 65162793
2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]oxolane (PubChem CID 65162793) has the molecular formula C14H18Cl2O3 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]oxolane.
| Compound Name | 2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]oxolane |
|---|---|
| PubChem CID | 65162793 |
| Molecular Formula | C14H18Cl2O3 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[2-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]ethyl]oxolane |
| SMILES | COc1cc(CCl)cc(Cl)c1OCCC1CCCO1 |
| InChI | InChI=1S/C14H18Cl2O3/c1-17-13-8-10(9-15)7-12(16)14(13)19-6-4-11-3-2-5-18-11/h7-8,11H,2-6,9H2,1H3 |
| InChIKey | BAQQSPSAUHCPGG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|