C16H23Cl2NO3 — CID 17290301
N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride (PubChem CID 17290301) has the molecular formula C16H23Cl2NO3 and a molecular weight of 348.27 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride.
| Compound Name | N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 17290301 |
| Molecular Formula | C16H23Cl2NO3 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride |
| SMILES | C=CCOc1c(Cl)cc(CNCC2CCCO2)cc1OC.Cl |
| InChI | InChI=1S/C16H22ClNO3.ClH/c1-3-6-21-16-14(17)8-12(9-15(16)19-2)10-18-11-13-5-4-7-20-13;/h3,8-9,13,18H,1,4-7,10-11H2,2H3;1H |
| InChIKey | YTAHQKHAKGKJGZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|