C16H27Cl3N2O2 — CID 17215707
N'-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215707) has the molecular formula C16H27Cl3N2O2 and a molecular weight of 385.76 g/mol. Its IUPAC name is N'-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215707 |
| Molecular Formula | C16H27Cl3N2O2 |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N'-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
| SMILES | C=CCOc1c(Cl)cc(CNCCCNCC)cc1OC.Cl.Cl |
| InChI | InChI=1S/C16H25ClN2O2.2ClH/c1-4-9-21-16-14(17)10-13(11-15(16)20-3)12-19-8-6-7-18-5-2;;/h4,10-11,18-19H,1,5-9,12H2,2-3H3;2*1H |
| InChIKey | WOCJEPYJNUGEGR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|