C16H25Cl2NO3 — CID 17211747
5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211747) has the molecular formula C16H25Cl2NO3 and a molecular weight of 350.29 g/mol. Its IUPAC name is 5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211747 |
| Molecular Formula | C16H25Cl2NO3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
| SMILES | C=CCOc1c(Cl)cc(CNCCCCCO)cc1OC.Cl |
| InChI | InChI=1S/C16H24ClNO3.ClH/c1-3-9-21-16-14(17)10-13(11-15(16)20-2)12-18-7-5-4-6-8-19;/h3,10-11,18-19H,1,4-9,12H2,2H3;1H |
| InChIKey | KHWPPVAVKMRSLV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|