C19H23Cl2NO2 — CID 17332568
N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride (PubChem CID 17332568) has the molecular formula C19H23Cl2NO2 and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride.
| Compound Name | N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 17332568 |
| Molecular Formula | C19H23Cl2NO2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;hydrochloride |
| SMILES | C=CCOc1c(Cl)cc(CNCc2ccc(C)cc2)cc1OC.Cl |
| InChI | InChI=1S/C19H22ClNO2.ClH/c1-4-9-23-19-17(20)10-16(11-18(19)22-3)13-21-12-15-7-5-14(2)6-8-15;/h4-8,10-11,21H,1,9,12-13H2,2-3H3;1H |
| InChIKey | AUMAJUNUYNADMX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|