C16H18ClNO3 — CID 4723923
N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(furan-2-yl)methanamine (PubChem CID 4723923) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(furan-2-yl)methanamine.
| Compound Name | N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(furan-2-yl)methanamine |
|---|---|
| PubChem CID | 4723923 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-(furan-2-yl)methanamine |
| SMILES | C=CCOc1c(Cl)cc(CNCc2ccco2)cc1OC |
| InChI | InChI=1S/C16H18ClNO3/c1-3-6-21-16-14(17)8-12(9-15(16)19-2)10-18-11-13-5-4-7-20-13/h3-5,7-9,18H,1,6,10-11H2,2H3 |
| InChIKey | FKTGUIOZTJJOCR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|