C18H32Cl2N2O2 — CID 17215845
N'-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215845) has the molecular formula C18H32Cl2N2O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is N'-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215845 |
| Molecular Formula | C18H32Cl2N2O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N'-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
| SMILES | C=CCc1cc(CNCCCNCC)cc(OC)c1OCC.Cl.Cl |
| InChI | InChI=1S/C18H30N2O2.2ClH/c1-5-9-16-12-15(14-20-11-8-10-19-6-2)13-17(21-4)18(16)22-7-3;;/h5,12-13,19-20H,1,6-11,14H2,2-4H3;2*1H |
| InChIKey | RNWHDTVPJUKRLE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|