C19H30ClNO2 — CID 17213329
N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]cyclohexanamine;hydrochloride (PubChem CID 17213329) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]cyclohexanamine;hydrochloride.
| Compound Name | N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]cyclohexanamine;hydrochloride |
|---|---|
| PubChem CID | 17213329 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]cyclohexanamine;hydrochloride |
| SMILES | C=CCc1cc(CNC2CCCCC2)cc(OC)c1OCC.Cl |
| InChI | InChI=1S/C19H29NO2.ClH/c1-4-9-16-12-15(13-18(21-3)19(16)22-5-2)14-20-17-10-7-6-8-11-17;/h4,12-13,17,20H,1,5-11,14H2,2-3H3;1H |
| InChIKey | XVXJKYCVJKJSLZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|