C18H29Cl2NO2 — CID 2962391
N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]cyclooctanamine;hydrochloride (PubChem CID 2962391) has the molecular formula C18H29Cl2NO2 and a molecular weight of 362.34 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]cyclooctanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]cyclooctanamine;hydrochloride |
|---|---|
| PubChem CID | 2962391 |
| Molecular Formula | C18H29Cl2NO2 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]cyclooctanamine;hydrochloride |
| SMILES | CCOc1c(Cl)cc(CNC2CCCCCCC2)cc1OC.Cl |
| InChI | InChI=1S/C18H28ClNO2.ClH/c1-3-22-18-16(19)11-14(12-17(18)21-2)13-20-15-9-7-5-4-6-8-10-15;/h11-12,15,20H,3-10,13H2,1-2H3;1H |
| InChIKey | OSYOPQREUOJKPL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |