C20H25NO2 — CID 126127366
N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-2-methylaniline (PubChem CID 126127366) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-2-methylaniline.
| Compound Name | N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126127366 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methyl]-2-methylaniline |
| SMILES | C=CCc1cc(CNc2ccccc2C)cc(OC)c1OCC |
| InChI | InChI=1S/C20H25NO2/c1-5-9-17-12-16(13-19(22-4)20(17)23-6-2)14-21-18-11-8-7-10-15(18)3/h5,7-8,10-13,21H,1,6,9,14H2,2-4H3 |
| InChIKey | XZBWTHWGUNOCQI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|