C23H29NO2 — CID 126124235
N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-3,4-dimethylaniline (PubChem CID 126124235) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-3,4-dimethylaniline.
| Compound Name | N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 126124235 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methyl]-3,4-dimethylaniline |
| SMILES | C=CCOc1c(CC=C)cc(CNc2ccc(C)c(C)c2)cc1OCC |
| InChI | InChI=1S/C23H29NO2/c1-6-9-20-14-19(15-22(25-8-3)23(20)26-12-7-2)16-24-21-11-10-17(4)18(5)13-21/h6-7,10-11,13-15,24H,1-2,8-9,12,16H2,3-5H3 |
| InChIKey | ROXYJMSZCBNWJN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|